C33H43FN2O2 — CID 142992455
ethane;2-[[6-[[3-ethoxypropyl(ethyl)amino]methyl]-2,3-dihydro-1H-inden-1-yl]amino]-1-(2-fluoro-4-phenylphenyl)ethanone (PubChem CID 142992455) has the molecular formula C33H43FN2O2 and a molecular weight of 518.72 g/mol. Its IUPAC name is ethane;2-[[6-[[3-ethoxypropyl(ethyl)amino]methyl]-2,3-dihydro-1H-inden-1-yl]amino]-1-(2-fluoro-4-phenylphenyl)ethanone.
| Compound Name | ethane;2-[[6-[[3-ethoxypropyl(ethyl)amino]methyl]-2,3-dihydro-1H-inden-1-yl]amino]-1-(2-fluoro-4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 142992455 |
| Molecular Formula | C33H43FN2O2 |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | ethane;2-[[6-[[3-ethoxypropyl(ethyl)amino]methyl]-2,3-dihydro-1H-inden-1-yl]amino]-1-(2-fluoro-4-phenylphenyl)ethanone |
| SMILES | CC.CCOCCCN(CC)Cc1ccc2c(c1)C(NCC(=O)c1ccc(-c3ccccc3)cc1F)CC2 |
| InChI | InChI=1S/C31H37FN2O2.C2H6/c1-3-34(17-8-18-36-4-2)22-23-11-12-25-14-16-30(28(25)19-23)33-21-31(35)27-15-13-26(20-29(27)32)24-9-6-5-7-10-24;1-2/h5-7,9-13,15,19-20,30,33H,3-4,8,14,16-18,21-22H2,1-2H3;1-2H3 |
| InChIKey | RQQPCHDMVBWGBY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|