C19H17F3O3 — CID 142992916
9-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-3-(trifluoromethyl)-2-oxabicyclo[4.4.1]undeca-1(10),4,6,8-tetraene-4-carboxylic acid (PubChem CID 142992916) has the molecular formula C19H17F3O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is 9-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-3-(trifluoromethyl)-2-oxabicyclo[4.4.1]undeca-1(10),4,6,8-tetraene-4-carboxylic acid.
| Compound Name | 9-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-3-(trifluoromethyl)-2-oxabicyclo[4.4.1]undeca-1(10),4,6,8-tetraene-4-carboxylic acid |
|---|---|
| PubChem CID | 142992916 |
| Molecular Formula | C19H17F3O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 9-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-3-(trifluoromethyl)-2-oxabicyclo[4.4.1]undeca-1(10),4,6,8-tetraene-4-carboxylic acid |
| SMILES | C/C=C\C=C/C=C/C1=CC=C2C=C(C(=O)O)C(C(F)(F)F)OC(=C1)C2 |
| InChI | InChI=1S/C19H17F3O3/c1-2-3-4-5-6-7-13-8-9-14-11-15(10-13)25-17(19(20,21)22)16(12-14)18(23)24/h2-10,12,17H,11H2,1H3,(H,23,24)/b3-2-,5-4-,7-6+ |
| InChIKey | WEGMIPVKFOVHDB-MUVPYGFYSA-N |
| XLogP | 4.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|