About 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen
3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen (PubChem CID 142993059) has the molecular formula C10H16N4O
and a molecular weight of 208.27 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen |
| PubChem CID | 142993059 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen |
| SMILES | CN(C)CCn1c(=O)[nH]c2cccnc21.[H][H] |
| InChI | InChI=1S/C10H14N4O.H2/c1-13(2)6-7-14-9-8(12-10(14)15)4-3-5-11-9;/h3-5H,6-7H2,1-2H3,(H,12,15);1H |
| InChIKey | HKOGWDUZZPMOET-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen?
The IUPAC name of 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen (CID 142993059) is 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen.
What is the SMILES notation for 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen?
The canonical SMILES for 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen is CN(C)CCn1c(=O)[nH]c2cccnc21.[H][H].
What is the InChIKey of 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen?
The InChIKey is HKOGWDUZZPMOET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O.H2/c1-13(2)6-7-14-9-8(12-10(14)15)4-3-5-11-9;/h3-5H,6-7H2,1-2H3,(H,12,15);1H.
What are the key properties of 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen?
3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen has a molecular weight of 208.27 g/mol, XLogP of 0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(dimethylamino)ethyl]-1H-imidazo[4,5-b]pyridin-2-one;molecular hydrogen is sourced from PubChem (CID 142993059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).