About 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen
1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen (PubChem CID 142993513) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen.
Molecular Properties
| Compound Name | 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen |
| PubChem CID | 142993513 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen |
| SMILES | CCCOC.CCCc1c(C=O)[nH]c(C=O)c1C.[H][H] |
| InChI | InChI=1S/C10H13NO2.C4H10O.H2/c1-3-4-8-7(2)9(5-12)11-10(8)6-13;1-3-4-5-2;/h5-6,11H,3-4H2,1-2H3;3-4H2,1-2H3;1H |
| InChIKey | QHISLCIFGQMOPF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen?
The IUPAC name of 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen (CID 142993513) is 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen.
What is the SMILES notation for 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen?
The canonical SMILES for 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen is CCCOC.CCCc1c(C=O)[nH]c(C=O)c1C.[H][H].
What is the InChIKey of 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen?
The InChIKey is QHISLCIFGQMOPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C4H10O.H2/c1-3-4-8-7(2)9(5-12)11-10(8)6-13;1-3-4-5-2;/h5-6,11H,3-4H2,1-2H3;3-4H2,1-2H3;1H.
What are the key properties of 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen?
1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen has a molecular weight of 255.36 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropane;3-methyl-4-propyl-1H-pyrrole-2,5-dicarbaldehyde;molecular hydrogen is sourced from PubChem (CID 142993513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).