About 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane
2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane (PubChem CID 142993811) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane.
Molecular Properties
| Compound Name | 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane |
| PubChem CID | 142993811 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane |
| SMILES | CC(C#N)c1cn(CO)c2ccccc12.CC(C)C.CO |
| InChI | InChI=1S/C12H12N2O.C4H10.CH4O/c1-9(6-13)11-7-14(8-15)12-5-3-2-4-10(11)12;1-4(2)3;1-2/h2-5,7,9,15H,8H2,1H3;4H,1-3H3;2H,1H3 |
| InChIKey | WSRALPUNLJWNEU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane?
The IUPAC name of 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane (CID 142993811) is 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane.
What is the SMILES notation for 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane?
The canonical SMILES for 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane is CC(C#N)c1cn(CO)c2ccccc12.CC(C)C.CO.
What is the InChIKey of 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane?
The InChIKey is WSRALPUNLJWNEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O.C4H10.CH4O/c1-9(6-13)11-7-14(8-15)12-5-3-2-4-10(11)12;1-4(2)3;1-2/h2-5,7,9,15H,8H2,1H3;4H,1-3H3;2H,1H3.
What are the key properties of 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane?
2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane has a molecular weight of 290.41 g/mol, XLogP of 3.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(hydroxymethyl)indol-3-yl]propanenitrile;methanol;2-methylpropane is sourced from PubChem (CID 142993811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).