C27H32N2O2 — CID 142994070
1-[4-[2-methyl-4-(4-propan-2-ylphenoxy)butan-2-yl]phenyl]-3-phenylurea (PubChem CID 142994070) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[4-[2-methyl-4-(4-propan-2-ylphenoxy)butan-2-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-methyl-4-(4-propan-2-ylphenoxy)butan-2-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 142994070 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-[4-[2-methyl-4-(4-propan-2-ylphenoxy)butan-2-yl]phenyl]-3-phenylurea |
| SMILES | CC(C)c1ccc(OCCC(C)(C)c2ccc(NC(=O)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-20(2)21-10-16-25(17-11-21)31-19-18-27(3,4)22-12-14-24(15-13-22)29-26(30)28-23-8-6-5-7-9-23/h5-17,20H,18-19H2,1-4H3,(H2,28,29,30) |
| InChIKey | MARVIGSPJMAMQL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |