C11H17N3O4S2 — CID 142994321
ethyl N-[(2,2-dioxo-1,3-dihydro-2,1-benzothiazol-6-yl)carbamothioyl]carbamate;molecular hydrogen (PubChem CID 142994321) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is ethyl N-[(2,2-dioxo-1,3-dihydro-2,1-benzothiazol-6-yl)carbamothioyl]carbamate;molecular hydrogen.
| Compound Name | ethyl N-[(2,2-dioxo-1,3-dihydro-2,1-benzothiazol-6-yl)carbamothioyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 142994321 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | ethyl N-[(2,2-dioxo-1,3-dihydro-2,1-benzothiazol-6-yl)carbamothioyl]carbamate;molecular hydrogen |
| SMILES | CCOC(=O)NC(=S)Nc1ccc2c(c1)NS(=O)(=O)C2.[H][H].[H][H] |
| InChI | InChI=1S/C11H13N3O4S2.2H2/c1-2-18-11(15)13-10(19)12-8-4-3-7-6-20(16,17)14-9(7)5-8;;/h3-5,14H,2,6H2,1H3,(H2,12,13,15,19);2*1H |
| InChIKey | GUSZLVFSTWZRRY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|