C21H23N3O2 — CID 142994358
(3R)-N-[4-(4-formamidophenyl)phenyl]-1-azabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 142994358) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3R)-N-[4-(4-formamidophenyl)phenyl]-1-azabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | (3R)-N-[4-(4-formamidophenyl)phenyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 142994358 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3R)-N-[4-(4-formamidophenyl)phenyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | O=CNc1ccc(-c2ccc(NC(=O)[C@H]3CN4CCC3CC4)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O2/c25-14-22-18-5-1-15(2-6-18)16-3-7-19(8-4-16)23-21(26)20-13-24-11-9-17(20)10-12-24/h1-8,14,17,20H,9-13H2,(H,22,25)(H,23,26)/t20-/m0/s1 |
| InChIKey | WOMSAYRZOQEJPL-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|