About N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene
N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene (PubChem CID 142994752) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene |
| PubChem CID | 142994752 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene |
| SMILES | C=CC.CC/C=C(C)/N=C(\CCCC)N(C)C |
| InChI | InChI=1S/C12H24N2.C3H6/c1-6-8-10-12(14(4)5)13-11(3)9-7-2;1-3-2/h9H,6-8,10H2,1-5H3;3H,1H2,2H3/b11-9+,13-12+; |
| InChIKey | ZZMYPCAEVMOWLK-RTCSUJOXSA-N |
| XLogP | 4.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene?
The IUPAC name of N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene (CID 142994752) is N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene.
What is the SMILES notation for N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene?
The canonical SMILES for N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene is C=CC.CC/C=C(C)/N=C(\CCCC)N(C)C.
What is the InChIKey of N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene?
The InChIKey is ZZMYPCAEVMOWLK-RTCSUJOXSA-N. The full InChI is InChI=1S/C12H24N2.C3H6/c1-6-8-10-12(14(4)5)13-11(3)9-7-2;1-3-2/h9H,6-8,10H2,1-5H3;3H,1H2,2H3/b11-9+,13-12+;.
What are the key properties of N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene?
N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene has a molecular weight of 238.42 g/mol, XLogP of 4.64, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-[(E)-pent-2-en-2-yl]pentanimidamide;prop-1-ene is sourced from PubChem (CID 142994752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).