About 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol
3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol (PubChem CID 142994922) has the molecular formula C17H18F3NOS
and a molecular weight of 341.40 g/mol. Its IUPAC name is 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol.
Molecular Properties
| Compound Name | 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol |
| PubChem CID | 142994922 |
| Molecular Formula | C17H18F3NOS |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol |
| SMILES | OC(CSc1ccccc1)C(NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NOS/c18-17(19,20)16(21-11-13-7-3-1-4-8-13)15(22)12-23-14-9-5-2-6-10-14/h1-10,15-16,21-22H,11-12H2 |
| InChIKey | XNJKQUXZGMRMDB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol?
The IUPAC name of 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol (CID 142994922) is 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol.
What is the SMILES notation for 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol?
The canonical SMILES for 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol is OC(CSc1ccccc1)C(NCc1ccccc1)C(F)(F)F.
What is the InChIKey of 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol?
The InChIKey is XNJKQUXZGMRMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F3NOS/c18-17(19,20)16(21-11-13-7-3-1-4-8-13)15(22)12-23-14-9-5-2-6-10-14/h1-10,15-16,21-22H,11-12H2.
What are the key properties of 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol?
3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol has a molecular weight of 341.40 g/mol, XLogP of 3.86, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)-4,4,4-trifluoro-1-phenylsulfanylbutan-2-ol is sourced from PubChem (CID 142994922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).