About 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene
4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene (PubChem CID 142994993) has the molecular formula C13H22N4O2
and a molecular weight of 266.35 g/mol. Its IUPAC name is 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene.
Molecular Properties
| Compound Name | 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene |
| PubChem CID | 142994993 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene |
| SMILES | C/C=C\C.C=CC.CC(=O)Nc1cn[nH]c1C(N)=O |
| InChI | InChI=1S/C6H8N4O2.C4H8.C3H6/c1-3(11)9-4-2-8-10-5(4)6(7)12;1-3-4-2;1-3-2/h2H,1H3,(H2,7,12)(H,8,10)(H,9,11);3-4H,1-2H3;3H,1H2,2H3/b;4-3-; |
| InChIKey | VETVNGRGOWXTRU-LWFKIUJUSA-N |
| XLogP | 2.24 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene?
The IUPAC name of 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene (CID 142994993) is 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene.
What is the SMILES notation for 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene?
The canonical SMILES for 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene is C/C=C\C.C=CC.CC(=O)Nc1cn[nH]c1C(N)=O.
What is the InChIKey of 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene?
The InChIKey is VETVNGRGOWXTRU-LWFKIUJUSA-N. The full InChI is InChI=1S/C6H8N4O2.C4H8.C3H6/c1-3(11)9-4-2-8-10-5(4)6(7)12;1-3-4-2;1-3-2/h2H,1H3,(H2,7,12)(H,8,10)(H,9,11);3-4H,1-2H3;3H,1H2,2H3/b;4-3-;.
What are the key properties of 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene?
4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene has a molecular weight of 266.35 g/mol, XLogP of 2.24, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetamido-1H-pyrazole-5-carboxamide;(Z)-but-2-ene;prop-1-ene is sourced from PubChem (CID 142994993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).