C15H25N5OS — CID 142995121
4-(methylamino)-N-(4-thiomorpholin-4-ylcyclohexyl)-1H-pyrazole-5-carboxamide (PubChem CID 142995121) has the molecular formula C15H25N5OS and a molecular weight of 323.47 g/mol. Its IUPAC name is 4-(methylamino)-N-(4-thiomorpholin-4-ylcyclohexyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-(methylamino)-N-(4-thiomorpholin-4-ylcyclohexyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 142995121 |
| Molecular Formula | C15H25N5OS |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 4-(methylamino)-N-(4-thiomorpholin-4-ylcyclohexyl)-1H-pyrazole-5-carboxamide |
| SMILES | CNc1cn[nH]c1C(=O)NC1CCC(N2CCSCC2)CC1 |
| InChI | InChI=1S/C15H25N5OS/c1-16-13-10-17-19-14(13)15(21)18-11-2-4-12(5-3-11)20-6-8-22-9-7-20/h10-12,16H,2-9H2,1H3,(H,17,19)(H,18,21) |
| InChIKey | RXOWZJIGLORPBK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |