About 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone
1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone (PubChem CID 142995246) has the molecular formula C11H9F3N2O2
and a molecular weight of 258.20 g/mol. Its IUPAC name is 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone |
| PubChem CID | 142995246 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone |
| SMILES | CCc1cc(C(F)(F)F)c2oc(C(C)=O)nc2n1 |
| InChI | InChI=1S/C11H9F3N2O2/c1-3-6-4-7(11(12,13)14)8-9(15-6)16-10(18-8)5(2)17/h4H,3H2,1-2H3 |
| InChIKey | TZZWYNAKUGPPFK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone?
The IUPAC name of 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone (CID 142995246) is 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone.
What is the SMILES notation for 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone?
The canonical SMILES for 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone is CCc1cc(C(F)(F)F)c2oc(C(C)=O)nc2n1.
What is the InChIKey of 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone?
The InChIKey is TZZWYNAKUGPPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2O2/c1-3-6-4-7(11(12,13)14)8-9(15-6)16-10(18-8)5(2)17/h4H,3H2,1-2H3.
What are the key properties of 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone?
1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone has a molecular weight of 258.20 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-ethyl-7-(trifluoromethyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]ethanone is sourced from PubChem (CID 142995246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).