About 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane
4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane (PubChem CID 142995319) has the molecular formula C18H27ClN2Sn
and a molecular weight of 425.59 g/mol. Its IUPAC name is 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane.
Molecular Properties
| Compound Name | 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane |
| PubChem CID | 142995319 |
| Molecular Formula | C18H27ClN2Sn |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane |
| SMILES | Cc1cccc(N2CCN(CCC3CCCCC3)[Sn]C2)c1Cl |
| InChI | InChI=1S/C18H27ClN2.Sn/c1-15-7-6-10-17(18(15)19)21(2)14-13-20-12-11-16-8-4-3-5-9-16;/h6-7,10,16H,2-5,8-9,11-14H2,1H3;/q-1;+1 |
| InChIKey | HNJNAPSSGGIRCY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane?
The IUPAC name of 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane (CID 142995319) is 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane.
What is the SMILES notation for 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane?
The canonical SMILES for 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane is Cc1cccc(N2CCN(CCC3CCCCC3)[Sn]C2)c1Cl.
What is the InChIKey of 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane?
The InChIKey is HNJNAPSSGGIRCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27ClN2.Sn/c1-15-7-6-10-17(18(15)19)21(2)14-13-20-12-11-16-8-4-3-5-9-16;/h6-7,10,16H,2-5,8-9,11-14H2,1H3;/q-1;+1.
What are the key properties of 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane?
4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane has a molecular weight of 425.59 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-3-methylphenyl)-1-(2-cyclohexylethyl)-1,4,2λ2-diazastanninane is sourced from PubChem (CID 142995319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).