About (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine
(Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine (PubChem CID 142995435) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine.
Molecular Properties
| Compound Name | (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine |
| PubChem CID | 142995435 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine |
| SMILES | C=C/C=N\c1nc(C)n(C)c1CC |
| InChI | InChI=1S/C10H15N3/c1-5-7-11-10-9(6-2)13(4)8(3)12-10/h5,7H,1,6H2,2-4H3/b11-7- |
| InChIKey | QEAWLKDXGDHZGE-XFFZJAGNSA-N |
| XLogP | 2.18 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine?
The IUPAC name of (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine (CID 142995435) is (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine.
What is the SMILES notation for (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine?
The canonical SMILES for (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine is C=C/C=N\c1nc(C)n(C)c1CC.
What is the InChIKey of (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine?
The InChIKey is QEAWLKDXGDHZGE-XFFZJAGNSA-N. The full InChI is InChI=1S/C10H15N3/c1-5-7-11-10-9(6-2)13(4)8(3)12-10/h5,7H,1,6H2,2-4H3/b11-7-.
What are the key properties of (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine?
(Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine has a molecular weight of 177.25 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(5-ethyl-1,2-dimethylimidazol-4-yl)prop-2-en-1-imine is sourced from PubChem (CID 142995435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).