C21H30N2O — CID 142995525
ethane;2-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-5-[(2E)-6-methylocta-2,4,7-trien-2-yl]-1,3,4-oxadiazole (PubChem CID 142995525) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is ethane;2-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-5-[(2E)-6-methylocta-2,4,7-trien-2-yl]-1,3,4-oxadiazole.
| Compound Name | ethane;2-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-5-[(2E)-6-methylocta-2,4,7-trien-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 142995525 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | ethane;2-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-5-[(2E)-6-methylocta-2,4,7-trien-2-yl]-1,3,4-oxadiazole |
| SMILES | C=C/C(C)=C\C=C(/C)c1nnc(/C(C)=C/C=CC(C)C=C)o1.CC |
| InChI | InChI=1S/C19H24N2O.C2H6/c1-7-14(3)10-9-11-16(5)18-20-21-19(22-18)17(6)13-12-15(4)8-2;1-2/h7-14H,1-2H2,3-6H3;1-2H3/b10-9?,15-12-,16-11+,17-13+; |
| InChIKey | UBWOXELQCUKVJV-FKZVUPBOSA-N |
| XLogP | 6.41 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|