About ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole
ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole (PubChem CID 142995649) has the molecular formula C20H27FN2
and a molecular weight of 314.45 g/mol. Its IUPAC name is ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole.
Molecular Properties
| Compound Name | ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole |
| PubChem CID | 142995649 |
| Molecular Formula | C20H27FN2 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole |
| SMILES | C(=C/c1n[nH]c2ccccc12)\c1ccccc1.CC.CC.CF |
| InChI | InChI=1S/C15H12N2.2C2H6.CH3F/c1-2-6-12(7-3-1)10-11-15-13-8-4-5-9-14(13)16-17-15;3*1-2/h1-11H,(H,16,17);2*1-2H3;1H3/b11-10+;;; |
| InChIKey | DQCGRXJTDUWTSL-QFVIODRTSA-N |
| XLogP | 6.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole?
The IUPAC name of ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole (CID 142995649) is ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole.
What is the SMILES notation for ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole?
The canonical SMILES for ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole is C(=C/c1n[nH]c2ccccc12)\c1ccccc1.CC.CC.CF.
What is the InChIKey of ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole?
The InChIKey is DQCGRXJTDUWTSL-QFVIODRTSA-N. The full InChI is InChI=1S/C15H12N2.2C2H6.CH3F/c1-2-6-12(7-3-1)10-11-15-13-8-4-5-9-14(13)16-17-15;3*1-2/h1-11H,(H,16,17);2*1-2H3;1H3/b11-10+;;;.
What are the key properties of ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole?
ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole has a molecular weight of 314.45 g/mol, XLogP of 6.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoromethane;3-[(E)-2-phenylethenyl]-1H-indazole is sourced from PubChem (CID 142995649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).