C24H27FN8O2 — CID 142995947
1-ethyl-3-[N'-[2-(3-fluoro-2-pyridinyl)-4-[2-(morpholin-4-ylmethyl)pyrimidin-5-yl]phenyl]carbamimidoyl]urea (PubChem CID 142995947) has the molecular formula C24H27FN8O2 and a molecular weight of 478.53 g/mol. Its IUPAC name is 1-ethyl-3-[N'-[2-(3-fluoro-2-pyridinyl)-4-[2-(morpholin-4-ylmethyl)pyrimidin-5-yl]phenyl]carbamimidoyl]urea.
| Compound Name | 1-ethyl-3-[N'-[2-(3-fluoro-2-pyridinyl)-4-[2-(morpholin-4-ylmethyl)pyrimidin-5-yl]phenyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 142995947 |
| Molecular Formula | C24H27FN8O2 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 1-ethyl-3-[N'-[2-(3-fluoro-2-pyridinyl)-4-[2-(morpholin-4-ylmethyl)pyrimidin-5-yl]phenyl]carbamimidoyl]urea |
| SMILES | CCNC(=O)N/C(N)=N/c1ccc(-c2cnc(CN3CCOCC3)nc2)cc1-c1ncccc1F |
| InChI | InChI=1S/C24H27FN8O2/c1-2-27-24(34)32-23(26)31-20-6-5-16(12-18(20)22-19(25)4-3-7-28-22)17-13-29-21(30-14-17)15-33-8-10-35-11-9-33/h3-7,12-14H,2,8-11,15H2,1H3,(H4,26,27,31,32,34) |
| InChIKey | XIWBRDWVVWSGDD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|