About 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea
1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea (PubChem CID 142995964) has the molecular formula C22H25N5O3
and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea |
| PubChem CID | 142995964 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea |
| SMILES | CCNC(=O)N/C(N)=N/c1ccc(-c2cccnc2)cc1-c1ccc(COCC)o1 |
| InChI | InChI=1S/C22H25N5O3/c1-3-25-22(28)27-21(23)26-19-9-7-15(16-6-5-11-24-13-16)12-18(19)20-10-8-17(30-20)14-29-4-2/h5-13H,3-4,14H2,1-2H3,(H4,23,25,26,27,28) |
| InChIKey | OBJJMLBRTOMXPO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea?
The IUPAC name of 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea (CID 142995964) is 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea.
What is the SMILES notation for 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea?
The canonical SMILES for 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea is CCNC(=O)N/C(N)=N/c1ccc(-c2cccnc2)cc1-c1ccc(COCC)o1.
What is the InChIKey of 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea?
The InChIKey is OBJJMLBRTOMXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O3/c1-3-25-22(28)27-21(23)26-19-9-7-15(16-6-5-11-24-13-16)12-18(19)20-10-8-17(30-20)14-29-4-2/h5-13H,3-4,14H2,1-2H3,(H4,23,25,26,27,28).
What are the key properties of 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea?
1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea has a molecular weight of 407.47 g/mol, XLogP of 3.81, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[N'-[2-[5-(ethoxymethyl)furan-2-yl]-4-pyridin-3-ylphenyl]carbamimidoyl]-3-ethylurea is sourced from PubChem (CID 142995964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).