C8H11N2O4+ — CID 142996211
[(2Z,4E)-3-amino-1-carboxy-6-methoxy-6-oxohexa-2,4-dienylidene]azanium (PubChem CID 142996211) has the molecular formula C8H11N2O4+ and a molecular weight of 199.19 g/mol. Its IUPAC name is [(2Z,4E)-3-amino-1-carboxy-6-methoxy-6-oxohexa-2,4-dienylidene]azanium.
| Compound Name | [(2Z,4E)-3-amino-1-carboxy-6-methoxy-6-oxohexa-2,4-dienylidene]azanium |
|---|---|
| PubChem CID | 142996211 |
| Molecular Formula | C8H11N2O4+ |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | [(2Z,4E)-3-amino-1-carboxy-6-methoxy-6-oxohexa-2,4-dienylidene]azanium |
| SMILES | COC(=O)/C=C/C(N)=C/C(=[NH2+])C(=O)O |
| InChI | InChI=1S/C8H10N2O4/c1-14-7(11)3-2-5(9)4-6(10)8(12)13/h2-4,10H,9H2,1H3,(H,12,13)/p+1/b3-2+,5-4-,10-6? |
| InChIKey | BNBMMFUGGYVZPJ-DKKNVNDHSA-O |
| XLogP | -2.16 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|