C26H42O2Si2 — CID 14299641
(17-ethynyl-13-methyl-3-trimethylsilyloxy-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)oxy-trimethylsilane (PubChem CID 14299641) has the molecular formula C26H42O2Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is (17-ethynyl-13-methyl-3-trimethylsilyloxy-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)oxy-trimethylsilane.
| Compound Name | (17-ethynyl-13-methyl-3-trimethylsilyloxy-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 14299641 |
| Molecular Formula | C26H42O2Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (17-ethynyl-13-methyl-3-trimethylsilyloxy-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)oxy-trimethylsilane |
| SMILES | C#CC1(O[Si](C)(C)C)CCC2C3CC=C4C=C(O[Si](C)(C)C)CCC4C3CCC21C |
| InChI | InChI=1S/C26H42O2Si2/c1-9-26(28-30(6,7)8)17-15-24-23-12-10-19-18-20(27-29(3,4)5)11-13-21(19)22(23)14-16-25(24,26)2/h1,10,18,21-24H,11-17H2,2-8H3 |
| InChIKey | NZZXHRLCRVDHQC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|