C28H35N3 — CID 142996445
acetylene;N'-amino-2-[4-[1-(3,5,5,8,8-pentamethylnaphthalen-2-yl)cyclopropyl]phenyl]ethanimidamide (PubChem CID 142996445) has the molecular formula C28H35N3 and a molecular weight of 413.61 g/mol. Its IUPAC name is acetylene;N'-amino-2-[4-[1-(3,5,5,8,8-pentamethylnaphthalen-2-yl)cyclopropyl]phenyl]ethanimidamide.
| Compound Name | acetylene;N'-amino-2-[4-[1-(3,5,5,8,8-pentamethylnaphthalen-2-yl)cyclopropyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 142996445 |
| Molecular Formula | C28H35N3 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | acetylene;N'-amino-2-[4-[1-(3,5,5,8,8-pentamethylnaphthalen-2-yl)cyclopropyl]phenyl]ethanimidamide |
| SMILES | C#C.Cc1cc2c(cc1C1(c3ccc(C/C(N)=N/N)cc3)CC1)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C26H33N3.C2H2/c1-17-14-21-22(25(4,5)11-10-24(21,2)3)16-20(17)26(12-13-26)19-8-6-18(7-9-19)15-23(27)29-28;1-2/h6-11,14,16H,12-13,15,28H2,1-5H3,(H2,27,29);1-2H |
| InChIKey | ZCOWFPYSJBXURR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|