C13H17F3N6 — CID 142996742
(Z)-[2,2,2-trifluoro-1-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]ethylidene]hydrazine (PubChem CID 142996742) has the molecular formula C13H17F3N6 and a molecular weight of 314.31 g/mol. Its IUPAC name is (Z)-[2,2,2-trifluoro-1-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]ethylidene]hydrazine.
| Compound Name | (Z)-[2,2,2-trifluoro-1-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]ethylidene]hydrazine |
|---|---|
| PubChem CID | 142996742 |
| Molecular Formula | C13H17F3N6 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (Z)-[2,2,2-trifluoro-1-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]ethylidene]hydrazine |
| SMILES | CCCC1=C(Cn2ccnc2)N=CN(/C(=N\N)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H17F3N6/c1-2-3-10-6-22(12(20-17)13(14,15)16)9-19-11(10)7-21-5-4-18-8-21/h4-5,8-9H,2-3,6-7,17H2,1H3/b20-12- |
| InChIKey | PEGKXPKGQUVKLV-NDENLUEZSA-N |
| XLogP | 2.12 |
| TPSA | 71.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|