About 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide
1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide (PubChem CID 14299702) has the molecular formula C8H20N2O2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide.
Molecular Properties
| Compound Name | 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide |
| PubChem CID | 14299702 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide |
| SMILES | C[N+]12CC[N+](C)(CC1)CC2.[OH-].[OH-] |
| InChI | InChI=1S/C8H18N2.2H2O/c1-9-3-6-10(2,7-4-9)8-5-9;;/h3-8H2,1-2H3;2*1H2/q+2;;/p-2 |
| InChIKey | VHXRULYSONTDNP-UHFFFAOYSA-L |
| XLogP | -0.45 |
| TPSA | 60.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide?
The IUPAC name of 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide (CID 14299702) is 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide.
What is the SMILES notation for 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide?
The canonical SMILES for 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide is C[N+]12CC[N+](C)(CC1)CC2.[OH-].[OH-].
What is the InChIKey of 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide?
The InChIKey is VHXRULYSONTDNP-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H18N2.2H2O/c1-9-3-6-10(2,7-4-9)8-5-9;;/h3-8H2,1-2H3;2*1H2/q+2;;/p-2.
What are the key properties of 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide?
1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide has a molecular weight of 176.26 g/mol, XLogP of -0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-1,4-diazoniabicyclo[2.2.2]octane dihydroxide is sourced from PubChem (CID 14299702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).