About 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen
1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen (PubChem CID 142997505) has the molecular formula C23H29N7O2
and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen |
| PubChem CID | 142997505 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen |
| SMILES | CCO.Cc1ncc2nc(-c3nc4cc(C(N)=O)ccc4n3C3CCCCC3)cnc2n1.[H][H] |
| InChI | InChI=1S/C21H21N7O.C2H6O.H2/c1-12-23-10-16-20(25-12)24-11-17(26-16)21-27-15-9-13(19(22)29)7-8-18(15)28(21)14-5-3-2-4-6-14;1-2-3;/h7-11,14H,2-6H2,1H3,(H2,22,29);3H,2H2,1H3;1H |
| InChIKey | HBHVEJHNENLYGP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen?
The IUPAC name of 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen (CID 142997505) is 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen.
What is the SMILES notation for 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen?
The canonical SMILES for 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen is CCO.Cc1ncc2nc(-c3nc4cc(C(N)=O)ccc4n3C3CCCCC3)cnc2n1.[H][H].
What is the InChIKey of 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen?
The InChIKey is HBHVEJHNENLYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N7O.C2H6O.H2/c1-12-23-10-16-20(25-12)24-11-17(26-16)21-27-15-9-13(19(22)29)7-8-18(15)28(21)14-5-3-2-4-6-14;1-2-3;/h7-11,14H,2-6H2,1H3,(H2,22,29);3H,2H2,1H3;1H.
What are the key properties of 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen?
1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen has a molecular weight of 435.53 g/mol, XLogP of 3.59, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-(2-methylpteridin-6-yl)benzimidazole-5-carboxamide;ethanol;molecular hydrogen is sourced from PubChem (CID 142997505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).