C17H29NO — CID 142997990
4-ethyl-1-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxypropyl]piperidine (PubChem CID 142997990) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 4-ethyl-1-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxypropyl]piperidine.
| Compound Name | 4-ethyl-1-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxypropyl]piperidine |
|---|---|
| PubChem CID | 142997990 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-ethyl-1-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxypropyl]piperidine |
| SMILES | C=C/C=C\C(=C/C)OCCCN1CCC(CC)CC1 |
| InChI | InChI=1S/C17H29NO/c1-4-7-9-17(6-3)19-15-8-12-18-13-10-16(5-2)11-14-18/h4,6-7,9,16H,1,5,8,10-15H2,2-3H3/b9-7-,17-6+ |
| InChIKey | XWYLZPCFVIHEOK-FJGJKEDSSA-N |
| XLogP | 4.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|