C20H24BrClN2O4S — CID 142998695
2-bromobuta-1,3-diene;6-chloro-1-(1-prop-2-enylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one (PubChem CID 142998695) has the molecular formula C20H24BrClN2O4S and a molecular weight of 503.85 g/mol. Its IUPAC name is 2-bromobuta-1,3-diene;6-chloro-1-(1-prop-2-enylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one.
| Compound Name | 2-bromobuta-1,3-diene;6-chloro-1-(1-prop-2-enylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 142998695 |
| Molecular Formula | C20H24BrClN2O4S |
| Molecular Weight | 503.85 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | 2-bromobuta-1,3-diene;6-chloro-1-(1-prop-2-enylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one |
| SMILES | C=CC(=C)Br.C=CCS(=O)(=O)N1CCC(N2C(=O)OCc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C16H19ClN2O4S.C4H5Br/c1-2-9-24(21,22)18-7-5-14(6-8-18)19-15-4-3-13(17)10-12(15)11-23-16(19)20;1-3-4(2)5/h2-4,10,14H,1,5-9,11H2;3H,1-2H2 |
| InChIKey | VBGAXJOSMORQNN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|