C29H46O3 — CID 142998900
[(3Z,5Z)-2,2,3,8,8-pentamethylnona-3,5-dien-4-yl] 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 142998900) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is [(3Z,5Z)-2,2,3,8,8-pentamethylnona-3,5-dien-4-yl] 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | [(3Z,5Z)-2,2,3,8,8-pentamethylnona-3,5-dien-4-yl] 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 142998900 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | [(3Z,5Z)-2,2,3,8,8-pentamethylnona-3,5-dien-4-yl] 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | C/C(=C(\C=C/CC(C)(C)C)OC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(C)(C)C |
| InChI | InChI=1S/C29H46O3/c1-19(27(5,6)7)23(15-14-16-26(2,3)4)32-25(31)20-17-21(28(8,9)10)24(30)22(18-20)29(11,12)13/h14-15,17-18,30H,16H2,1-13H3/b15-14-,23-19- |
| InChIKey | WIPUHCBWKKZAPZ-UBFLIBTNSA-N |
| XLogP | 8.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|