About 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol
3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol (PubChem CID 142999065) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol |
| PubChem CID | 142999065 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol |
| SMILES | NC1Cc2ccccc2[C@H]1CS(=O)CCCO |
| InChI | InChI=1S/C13H19NO2S/c14-13-8-10-4-1-2-5-11(10)12(13)9-17(16)7-3-6-15/h1-2,4-5,12-13,15H,3,6-9,14H2/t12-,13?,17?/m1/s1 |
| InChIKey | TVZRFZIYROXFJN-SFYCDEOASA-N |
| XLogP | 0.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol?
The IUPAC name of 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol (CID 142999065) is 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol.
What is the SMILES notation for 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol?
The canonical SMILES for 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol is NC1Cc2ccccc2[C@H]1CS(=O)CCCO.
What is the InChIKey of 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol?
The InChIKey is TVZRFZIYROXFJN-SFYCDEOASA-N. The full InChI is InChI=1S/C13H19NO2S/c14-13-8-10-4-1-2-5-11(10)12(13)9-17(16)7-3-6-15/h1-2,4-5,12-13,15H,3,6-9,14H2/t12-,13?,17?/m1/s1.
What are the key properties of 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol?
3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol has a molecular weight of 253.37 g/mol, XLogP of 0.78, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1R)-2-amino-2,3-dihydro-1H-inden-1-yl]methylsulfinyl]propan-1-ol is sourced from PubChem (CID 142999065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).