About butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene
butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene (PubChem CID 142999553) has the molecular formula C22H32O2
and a molecular weight of 328.50 g/mol. Its IUPAC name is butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene.
Molecular Properties
| Compound Name | butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene |
| PubChem CID | 142999553 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene |
| SMILES | CC.CCC(C)=O.COCc1cc(C)ccc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C16H18O.C4H8O.C2H6/c1-12-4-7-14(8-5-12)16-9-6-13(2)10-15(16)11-17-3;1-3-4(2)5;1-2/h4-10H,11H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | AGWSMZYJVZBPFX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene?
The IUPAC name of butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene (CID 142999553) is butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene.
What is the SMILES notation for butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene?
The canonical SMILES for butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene is CC.CCC(C)=O.COCc1cc(C)ccc1-c1ccc(C)cc1.
What is the InChIKey of butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene?
The InChIKey is AGWSMZYJVZBPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O.C4H8O.C2H6/c1-12-4-7-14(8-5-12)16-9-6-13(2)10-15(16)11-17-3;1-3-4(2)5;1-2/h4-10H,11H2,1-3H3;3H2,1-2H3;1-2H3.
What are the key properties of butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene?
butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene has a molecular weight of 328.50 g/mol, XLogP of 6.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;ethane;2-(methoxymethyl)-4-methyl-1-(4-methylphenyl)benzene is sourced from PubChem (CID 142999553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).