C41H54FN3O4 — CID 142999578
3-[1-[3-fluoro-4-[[2-(1,4-oxazepan-4-yl)-5-pyrrolidin-1-ylphenyl]methoxy]phenyl]ethenyl-methylamino]-4-nonylbenzoic acid (PubChem CID 142999578) has the molecular formula C41H54FN3O4 and a molecular weight of 671.90 g/mol. Its IUPAC name is 3-[1-[3-fluoro-4-[[2-(1,4-oxazepan-4-yl)-5-pyrrolidin-1-ylphenyl]methoxy]phenyl]ethenyl-methylamino]-4-nonylbenzoic acid.
| Compound Name | 3-[1-[3-fluoro-4-[[2-(1,4-oxazepan-4-yl)-5-pyrrolidin-1-ylphenyl]methoxy]phenyl]ethenyl-methylamino]-4-nonylbenzoic acid |
|---|---|
| PubChem CID | 142999578 |
| Molecular Formula | C41H54FN3O4 |
| Molecular Weight | 671.90 g/mol |
| Exact Mass | 671.41 |
| IUPAC Name | 3-[1-[3-fluoro-4-[[2-(1,4-oxazepan-4-yl)-5-pyrrolidin-1-ylphenyl]methoxy]phenyl]ethenyl-methylamino]-4-nonylbenzoic acid |
| SMILES | C=C(c1ccc(OCc2cc(N3CCCC3)ccc2N2CCCOCC2)c(F)c1)N(C)c1cc(C(=O)O)ccc1CCCCCCCCC |
| InChI | InChI=1S/C41H54FN3O4/c1-4-5-6-7-8-9-10-14-32-15-16-34(41(46)47)29-39(32)43(3)31(2)33-17-20-40(37(42)28-33)49-30-35-27-36(44-21-11-12-22-44)18-19-38(35)45-23-13-25-48-26-24-45/h15-20,27-29H,2,4-14,21-26,30H2,1,3H3,(H,46,47) |
| InChIKey | DPKGARJYHIQGAR-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.90 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|