C25H28ClNO3 — CID 142999951
2-amino-2-[3-[3-(3-chloro-4-phenylmethoxyphenyl)phenyl]propyl]propane-1,3-diol (PubChem CID 142999951) has the molecular formula C25H28ClNO3 and a molecular weight of 425.96 g/mol. Its IUPAC name is 2-amino-2-[3-[3-(3-chloro-4-phenylmethoxyphenyl)phenyl]propyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[3-[3-(3-chloro-4-phenylmethoxyphenyl)phenyl]propyl]propane-1,3-diol |
|---|---|
| PubChem CID | 142999951 |
| Molecular Formula | C25H28ClNO3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-amino-2-[3-[3-(3-chloro-4-phenylmethoxyphenyl)phenyl]propyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CCCc1cccc(-c2ccc(OCc3ccccc3)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H28ClNO3/c26-23-15-22(11-12-24(23)30-16-20-6-2-1-3-7-20)21-10-4-8-19(14-21)9-5-13-25(27,17-28)18-29/h1-4,6-8,10-12,14-15,28-29H,5,9,13,16-18,27H2 |
| InChIKey | BQCGQCYYHPLTON-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |