C32H40F5N3O — CID 143000147
N-[3-(2-cyclohexylethyl)-5-(4-fluorophenyl)pyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide;ethane (PubChem CID 143000147) has the molecular formula C32H40F5N3O and a molecular weight of 577.68 g/mol. Its IUPAC name is N-[3-(2-cyclohexylethyl)-5-(4-fluorophenyl)pyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide;ethane.
| Compound Name | N-[3-(2-cyclohexylethyl)-5-(4-fluorophenyl)pyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 143000147 |
| Molecular Formula | C32H40F5N3O |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | N-[3-(2-cyclohexylethyl)-5-(4-fluorophenyl)pyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide;ethane |
| SMILES | CC.CC.Cc1c(F)c(F)c(F)c(F)c1CC(=O)N(C)c1ncc(-c2ccc(F)cc2)nc1CCC1CCCCC1 |
| InChI | InChI=1S/C28H28F5N3O.2C2H6/c1-16-20(25(31)27(33)26(32)24(16)30)14-23(37)36(2)28-21(13-8-17-6-4-3-5-7-17)35-22(15-34-28)18-9-11-19(29)12-10-18;2*1-2/h9-12,15,17H,3-8,13-14H2,1-2H3;2*1-2H3 |
| InChIKey | CJLIEZIDWGABAR-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|