C34H42N4O — CID 143000878
N-[5-(4-aminophenyl)-3-[(3,5,8-trimethyl-3-bicyclo[7.1.0]dec-8-enyl)methyl]pyrazin-2-yl]-4-phenylbutanamide (PubChem CID 143000878) has the molecular formula C34H42N4O and a molecular weight of 522.74 g/mol. Its IUPAC name is N-[5-(4-aminophenyl)-3-[(3,5,8-trimethyl-3-bicyclo[7.1.0]dec-8-enyl)methyl]pyrazin-2-yl]-4-phenylbutanamide.
| Compound Name | N-[5-(4-aminophenyl)-3-[(3,5,8-trimethyl-3-bicyclo[7.1.0]dec-8-enyl)methyl]pyrazin-2-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 143000878 |
| Molecular Formula | C34H42N4O |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | N-[5-(4-aminophenyl)-3-[(3,5,8-trimethyl-3-bicyclo[7.1.0]dec-8-enyl)methyl]pyrazin-2-yl]-4-phenylbutanamide |
| SMILES | CC1=C2CC2CC(C)(Cc2nc(-c3ccc(N)cc3)cnc2NC(=O)CCCc2ccccc2)CC(C)CC1 |
| InChI | InChI=1S/C34H42N4O/c1-23-12-13-24(2)29-18-27(29)20-34(3,19-23)21-30-33(36-22-31(37-30)26-14-16-28(35)17-15-26)38-32(39)11-7-10-25-8-5-4-6-9-25/h4-6,8-9,14-17,22-23,27H,7,10-13,18-21,35H2,1-3H3,(H,36,38,39) |
| InChIKey | GHMOXGWHIUJPDW-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|