C19H25N3O — CID 143000946
(3E,5Z)-N-(5-cyclohexa-1,3-dien-1-yl-3-methyl-1,2-dihydropyrazin-2-yl)-3-methylhepta-3,5-dienamide (PubChem CID 143000946) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (3E,5Z)-N-(5-cyclohexa-1,3-dien-1-yl-3-methyl-1,2-dihydropyrazin-2-yl)-3-methylhepta-3,5-dienamide.
| Compound Name | (3E,5Z)-N-(5-cyclohexa-1,3-dien-1-yl-3-methyl-1,2-dihydropyrazin-2-yl)-3-methylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 143000946 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (3E,5Z)-N-(5-cyclohexa-1,3-dien-1-yl-3-methyl-1,2-dihydropyrazin-2-yl)-3-methylhepta-3,5-dienamide |
| SMILES | C/C=C\C=C(/C)CC(=O)NC1NC=C(C2=CC=CCC2)N=C1C |
| InChI | InChI=1S/C19H25N3O/c1-4-5-9-14(2)12-18(23)22-19-15(3)21-17(13-20-19)16-10-7-6-8-11-16/h4-7,9-10,13,19-20H,8,11-12H2,1-3H3,(H,22,23)/b5-4-,14-9+ |
| InChIKey | QKJOMEOJYNEMHA-NAJRDQDTSA-N |
| XLogP | 3.52 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|