C30H29F4N3O2 — CID 143000950
ethane;N-[5-(4-hydroxyphenyl)-3-(2-phenylethyl)pyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide (PubChem CID 143000950) has the molecular formula C30H29F4N3O2 and a molecular weight of 539.57 g/mol. Its IUPAC name is ethane;N-[5-(4-hydroxyphenyl)-3-(2-phenylethyl)pyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide.
| Compound Name | ethane;N-[5-(4-hydroxyphenyl)-3-(2-phenylethyl)pyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 143000950 |
| Molecular Formula | C30H29F4N3O2 |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | ethane;N-[5-(4-hydroxyphenyl)-3-(2-phenylethyl)pyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide |
| SMILES | CC.Cc1c(F)c(F)c(F)c(F)c1CC(=O)N(C)c1ncc(-c2ccc(O)cc2)nc1CCc1ccccc1 |
| InChI | InChI=1S/C28H23F4N3O2.C2H6/c1-16-20(25(30)27(32)26(31)24(16)29)14-23(37)35(2)28-21(13-8-17-6-4-3-5-7-17)34-22(15-33-28)18-9-11-19(36)12-10-18;1-2/h3-7,9-12,15,36H,8,13-14H2,1-2H3;1-2H3 |
| InChIKey | JRWJPLAZEZOHHV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|