C27H25F4N3O2S — CID 143001043
ethane;N-[5-(4-methoxyphenyl)-3-thiophen-2-ylpyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide (PubChem CID 143001043) has the molecular formula C27H25F4N3O2S and a molecular weight of 531.58 g/mol. Its IUPAC name is ethane;N-[5-(4-methoxyphenyl)-3-thiophen-2-ylpyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide.
| Compound Name | ethane;N-[5-(4-methoxyphenyl)-3-thiophen-2-ylpyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 143001043 |
| Molecular Formula | C27H25F4N3O2S |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | ethane;N-[5-(4-methoxyphenyl)-3-thiophen-2-ylpyrazin-2-yl]-N-methyl-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide |
| SMILES | CC.COc1ccc(-c2cnc(N(C)C(=O)Cc3c(C)c(F)c(F)c(F)c3F)c(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C25H19F4N3O2S.C2H6/c1-13-16(21(27)23(29)22(28)20(13)26)11-19(33)32(2)25-24(18-5-4-10-35-18)31-17(12-30-25)14-6-8-15(34-3)9-7-14;1-2/h4-10,12H,11H2,1-3H3;1-2H3 |
| InChIKey | DAYCIBWPQRANHA-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|