C26H22FN3O2 — CID 143001152
N-[5-(4-fluorophenyl)-3-[hydroxy(phenyl)methyl]pyrazin-2-yl]-2-(4-methylphenyl)acetamide (PubChem CID 143001152) has the molecular formula C26H22FN3O2 and a molecular weight of 427.48 g/mol. Its IUPAC name is N-[5-(4-fluorophenyl)-3-[hydroxy(phenyl)methyl]pyrazin-2-yl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[5-(4-fluorophenyl)-3-[hydroxy(phenyl)methyl]pyrazin-2-yl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 143001152 |
| Molecular Formula | C26H22FN3O2 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[5-(4-fluorophenyl)-3-[hydroxy(phenyl)methyl]pyrazin-2-yl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2ncc(-c3ccc(F)cc3)nc2C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22FN3O2/c1-17-7-9-18(10-8-17)15-23(31)30-26-24(25(32)20-5-3-2-4-6-20)29-22(16-28-26)19-11-13-21(27)14-12-19/h2-14,16,25,32H,15H2,1H3,(H,28,30,31) |
| InChIKey | ONTNCGPMPDXUQL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |