C24H38N2O — CID 143001469
(4R)-2-(cyclobutyloxymethyl)-5-methyl-4-phenyl-4,5-dihydro-1H-imidazole;ethane;(2Z,4Z)-hepta-2,4-diene (PubChem CID 143001469) has the molecular formula C24H38N2O and a molecular weight of 370.58 g/mol. Its IUPAC name is (4R)-2-(cyclobutyloxymethyl)-5-methyl-4-phenyl-4,5-dihydro-1H-imidazole;ethane;(2Z,4Z)-hepta-2,4-diene.
| Compound Name | (4R)-2-(cyclobutyloxymethyl)-5-methyl-4-phenyl-4,5-dihydro-1H-imidazole;ethane;(2Z,4Z)-hepta-2,4-diene |
|---|---|
| PubChem CID | 143001469 |
| Molecular Formula | C24H38N2O |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | (4R)-2-(cyclobutyloxymethyl)-5-methyl-4-phenyl-4,5-dihydro-1H-imidazole;ethane;(2Z,4Z)-hepta-2,4-diene |
| SMILES | C/C=C\C=C/CC.CC.CC1NC(COC2CCC2)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H20N2O.C7H12.C2H6/c1-11-15(12-6-3-2-4-7-12)17-14(16-11)10-18-13-8-5-9-13;1-3-5-7-6-4-2;1-2/h2-4,6-7,11,13,15H,5,8-10H2,1H3,(H,16,17);3,5-7H,4H2,1-2H3;1-2H3/b;5-3-,7-6-;/t11?,15-;;/m0../s1 |
| InChIKey | QTCWVMGKKZGZHE-OGJMKKIHSA-N |
| XLogP | 6.24 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|