About 2-(N-iodoanilino)ethanol
2-(N-iodoanilino)ethanol (PubChem CID 143001889) has the molecular formula C8H10INO
and a molecular weight of 263.08 g/mol. Its IUPAC name is 2-(N-iodoanilino)ethanol.
Molecular Properties
| Compound Name | 2-(N-iodoanilino)ethanol |
| PubChem CID | 143001889 |
| Molecular Formula | C8H10INO |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 2-(N-iodoanilino)ethanol |
| SMILES | OCCN(I)c1ccccc1 |
| InChI | InChI=1S/C8H10INO/c9-10(6-7-11)8-4-2-1-3-5-8/h1-5,11H,6-7H2 |
| InChIKey | QMFVYUGOJPVLMI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(N-iodoanilino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-iodoanilino)ethanol?
The IUPAC name of 2-(N-iodoanilino)ethanol (CID 143001889) is 2-(N-iodoanilino)ethanol.
What is the SMILES notation for 2-(N-iodoanilino)ethanol?
The canonical SMILES for 2-(N-iodoanilino)ethanol is OCCN(I)c1ccccc1.
What is the InChIKey of 2-(N-iodoanilino)ethanol?
The InChIKey is QMFVYUGOJPVLMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10INO/c9-10(6-7-11)8-4-2-1-3-5-8/h1-5,11H,6-7H2.
What are the key properties of 2-(N-iodoanilino)ethanol?
2-(N-iodoanilino)ethanol has a molecular weight of 263.08 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-iodoanilino)ethanol is sourced from PubChem (CID 143001889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).