C9H17N — CID 143002434
ethane;N-[(1Z)-3-methylbuta-1,3-dienyl]ethanimine (PubChem CID 143002434) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is ethane;N-[(1Z)-3-methylbuta-1,3-dienyl]ethanimine.
| Compound Name | ethane;N-[(1Z)-3-methylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 143002434 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | ethane;N-[(1Z)-3-methylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C(C)/C=C\N=C\C.CC |
| InChI | InChI=1S/C7H11N.C2H6/c1-4-8-6-5-7(2)3;1-2/h4-6H,2H2,1,3H3;1-2H3/b6-5-,8-4+; |
| InChIKey | XDRRONRPHACZOD-KCWJKURDSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|