About ethene;1-ethylpyrrolidin-2-one
ethene;1-ethylpyrrolidin-2-one (PubChem CID 143002656) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is ethene;1-ethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | ethene;1-ethylpyrrolidin-2-one |
| PubChem CID | 143002656 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | ethene;1-ethylpyrrolidin-2-one |
| SMILES | C=C.CCN1CCCC1=O |
| InChI | InChI=1S/C6H11NO.C2H4/c1-2-7-5-3-4-6(7)8;1-2/h2-5H2,1H3;1-2H2 |
| InChIKey | USXRMRALLKCINY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-ethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-ethylpyrrolidin-2-one?
The IUPAC name of ethene;1-ethylpyrrolidin-2-one (CID 143002656) is ethene;1-ethylpyrrolidin-2-one.
What is the SMILES notation for ethene;1-ethylpyrrolidin-2-one?
The canonical SMILES for ethene;1-ethylpyrrolidin-2-one is C=C.CCN1CCCC1=O.
What is the InChIKey of ethene;1-ethylpyrrolidin-2-one?
The InChIKey is USXRMRALLKCINY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C2H4/c1-2-7-5-3-4-6(7)8;1-2/h2-5H2,1H3;1-2H2.
What are the key properties of ethene;1-ethylpyrrolidin-2-one?
ethene;1-ethylpyrrolidin-2-one has a molecular weight of 141.21 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-ethylpyrrolidin-2-one is sourced from PubChem (CID 143002656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).