C29H37F2N3O3 — CID 143002709
(3S)-1-butyl-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]propan-2-yl]-4-ethyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 143002709) has the molecular formula C29H37F2N3O3 and a molecular weight of 513.63 g/mol. Its IUPAC name is (3S)-1-butyl-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]propan-2-yl]-4-ethyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-butyl-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]propan-2-yl]-4-ethyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 143002709 |
| Molecular Formula | C29H37F2N3O3 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (3S)-1-butyl-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]propan-2-yl]-4-ethyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCN1C[C@@H](C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)[C@H]2Cc3ccccc3CN2)C(CC)C1=O |
| InChI | InChI=1S/C29H37F2N3O3/c1-3-5-10-34-17-24(23(4-2)29(34)37)28(36)33-26(13-18-11-21(30)15-22(31)12-18)27(35)25-14-19-8-6-7-9-20(19)16-32-25/h6-9,11-12,15,23-27,32,35H,3-5,10,13-14,16-17H2,1-2H3,(H,33,36)/t23?,24-,25-,26+,27-/m1/s1 |
| InChIKey | FLNFAVRMQSZXEH-YUDHZRILSA-N |
| XLogP | 3.35 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |