About 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene
3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene (PubChem CID 143002894) has the molecular formula C12H12Cl2
and a molecular weight of 227.13 g/mol. Its IUPAC name is 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene |
| PubChem CID | 143002894 |
| Molecular Formula | C12H12Cl2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene |
| SMILES | C=CCC1CC(Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H12Cl2/c1-2-3-8-6-12(14)11-7-9(13)4-5-10(8)11/h2,4-5,7-8,12H,1,3,6H2 |
| InChIKey | YIEPWLOXABIJDH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene?
The IUPAC name of 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene (CID 143002894) is 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene.
What is the SMILES notation for 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene?
The canonical SMILES for 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene is C=CCC1CC(Cl)c2cc(Cl)ccc21.
What is the InChIKey of 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene?
The InChIKey is YIEPWLOXABIJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2/c1-2-3-8-6-12(14)11-7-9(13)4-5-10(8)11/h2,4-5,7-8,12H,1,3,6H2.
What are the key properties of 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene?
3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene has a molecular weight of 227.13 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-1-prop-2-enyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 143002894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).