C22H32N2 — CID 143002915
1-[(1R)-3-[(2Z,4Z)-hexa-2,4-dienyl]-6-methyl-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine (PubChem CID 143002915) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-[(1R)-3-[(2Z,4Z)-hexa-2,4-dienyl]-6-methyl-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine.
| Compound Name | 1-[(1R)-3-[(2Z,4Z)-hexa-2,4-dienyl]-6-methyl-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine |
|---|---|
| PubChem CID | 143002915 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1-[(1R)-3-[(2Z,4Z)-hexa-2,4-dienyl]-6-methyl-2,3-dihydro-1H-inden-1-yl]-3,3-dimethylpiperazine |
| SMILES | C/C=C\C=C/CC1C[C@@H](N2CCNC(C)(C)C2)c2cc(C)ccc21 |
| InChI | InChI=1S/C22H32N2/c1-5-6-7-8-9-18-15-21(20-14-17(2)10-11-19(18)20)24-13-12-23-22(3,4)16-24/h5-8,10-11,14,18,21,23H,9,12-13,15-16H2,1-4H3/b6-5-,8-7-/t18?,21-/m1/s1 |
| InChIKey | GANZLSUUNJOITP-QNSMRMMMSA-N |
| XLogP | 4.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|