About [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate
[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate (PubChem CID 143003959) has the molecular formula C23H36N2O2
and a molecular weight of 372.55 g/mol. Its IUPAC name is [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate.
Molecular Properties
| Compound Name | [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate |
| PubChem CID | 143003959 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate |
| SMILES | C/C=C\C(=C/CC)COC(=O)N(CCC)CCC(C)c1ccc(C)c(C)n1 |
| InChI | InChI=1S/C23H36N2O2/c1-7-10-21(11-8-2)17-27-23(26)25(15-9-3)16-14-19(5)22-13-12-18(4)20(6)24-22/h7,10-13,19H,8-9,14-17H2,1-6H3/b10-7-,21-11+ |
| InChIKey | MZEBRBQWIFFDQQ-OSRKHQHYSA-N |
| XLogP | 5.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate?
The IUPAC name of [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate (CID 143003959) is [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate.
What is the SMILES notation for [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate?
The canonical SMILES for [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate is C/C=C\C(=C/CC)COC(=O)N(CCC)CCC(C)c1ccc(C)c(C)n1.
What is the InChIKey of [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate?
The InChIKey is MZEBRBQWIFFDQQ-OSRKHQHYSA-N. The full InChI is InChI=1S/C23H36N2O2/c1-7-10-21(11-8-2)17-27-23(26)25(15-9-3)16-14-19(5)22-13-12-18(4)20(6)24-22/h7,10-13,19H,8-9,14-17H2,1-6H3/b10-7-,21-11+.
What are the key properties of [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate?
[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate has a molecular weight of 372.55 g/mol, XLogP of 5.95, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-[3-(5,6-dimethyl-2-pyridinyl)butyl]-N-propylcarbamate is sourced from PubChem (CID 143003959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).