C16H26N2O — CID 143004103
(2Z,4Z)-6-[[(2-aminocyclohexyl)amino]methyl]-4-ethenylhepta-2,4,6-trien-2-ol (PubChem CID 143004103) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is (2Z,4Z)-6-[[(2-aminocyclohexyl)amino]methyl]-4-ethenylhepta-2,4,6-trien-2-ol.
| Compound Name | (2Z,4Z)-6-[[(2-aminocyclohexyl)amino]methyl]-4-ethenylhepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 143004103 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (2Z,4Z)-6-[[(2-aminocyclohexyl)amino]methyl]-4-ethenylhepta-2,4,6-trien-2-ol |
| SMILES | C=CC(/C=C(/C)O)=C/C(=C)CNC1CCCCC1N |
| InChI | InChI=1S/C16H26N2O/c1-4-14(10-13(3)19)9-12(2)11-18-16-8-6-5-7-15(16)17/h4,9-10,15-16,18-19H,1-2,5-8,11,17H2,3H3/b13-10-,14-9- |
| InChIKey | GJERZCPGNJXASS-DVICISQYSA-N |
| XLogP | 2.98 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|