C23H43NO4 — CID 143004335
(3Z,5E)-4-ethyl-6,7-dimethoxyhepta-1,3,5-triene;(2R)-1-[ethyl-[(1R)-2-methoxycyclohexyl]amino]propan-2-ol (PubChem CID 143004335) has the molecular formula C23H43NO4 and a molecular weight of 397.60 g/mol. Its IUPAC name is (3Z,5E)-4-ethyl-6,7-dimethoxyhepta-1,3,5-triene;(2R)-1-[ethyl-[(1R)-2-methoxycyclohexyl]amino]propan-2-ol.
| Compound Name | (3Z,5E)-4-ethyl-6,7-dimethoxyhepta-1,3,5-triene;(2R)-1-[ethyl-[(1R)-2-methoxycyclohexyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 143004335 |
| Molecular Formula | C23H43NO4 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | (3Z,5E)-4-ethyl-6,7-dimethoxyhepta-1,3,5-triene;(2R)-1-[ethyl-[(1R)-2-methoxycyclohexyl]amino]propan-2-ol |
| SMILES | C=C/C=C(\C=C(/COC)OC)CC.CCN(C[C@@H](C)O)[C@@H]1CCCCC1OC |
| InChI | InChI=1S/C12H25NO2.C11H18O2/c1-4-13(9-10(2)14)11-7-5-6-8-12(11)15-3;1-5-7-10(6-2)8-11(13-4)9-12-3/h10-12,14H,4-9H2,1-3H3;5,7-8H,1,6,9H2,2-4H3/b;10-7-,11-8+/t10-,11-,12?;/m1./s1 |
| InChIKey | ABWFXRRXSXWIFU-XACHHGHWSA-N |
| XLogP | 4.33 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|