C23H23F5O5S — CID 143004385
methyl (Z)-2-(3,4-difluorophenoxy)-6,6,7-trifluoro-4-methyl-3-[4-(methylsulfonylmethyl)phenyl]hept-2-enoate (PubChem CID 143004385) has the molecular formula C23H23F5O5S and a molecular weight of 506.49 g/mol. Its IUPAC name is methyl (Z)-2-(3,4-difluorophenoxy)-6,6,7-trifluoro-4-methyl-3-[4-(methylsulfonylmethyl)phenyl]hept-2-enoate.
| Compound Name | methyl (Z)-2-(3,4-difluorophenoxy)-6,6,7-trifluoro-4-methyl-3-[4-(methylsulfonylmethyl)phenyl]hept-2-enoate |
|---|---|
| PubChem CID | 143004385 |
| Molecular Formula | C23H23F5O5S |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | methyl (Z)-2-(3,4-difluorophenoxy)-6,6,7-trifluoro-4-methyl-3-[4-(methylsulfonylmethyl)phenyl]hept-2-enoate |
| SMILES | COC(=O)/C(Oc1ccc(F)c(F)c1)=C(/c1ccc(CS(C)(=O)=O)cc1)C(C)CC(F)(F)CF |
| InChI | InChI=1S/C23H23F5O5S/c1-14(11-23(27,28)13-24)20(16-6-4-15(5-7-16)12-34(3,30)31)21(22(29)32-2)33-17-8-9-18(25)19(26)10-17/h4-10,14H,11-13H2,1-3H3/b21-20- |
| InChIKey | ZQFCIQHWNXGLNJ-MRCUWXFGSA-N |
| XLogP | 5.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|