About 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine
4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine (PubChem CID 143004800) has the molecular formula C14H29N3O
and a molecular weight of 255.41 g/mol. Its IUPAC name is 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine.
Molecular Properties
| Compound Name | 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine |
| PubChem CID | 143004800 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine |
| SMILES | CC/C=C(/C)N1CCNCC1.CN1CCOCC1 |
| InChI | InChI=1S/C9H18N2.C5H11NO/c1-3-4-9(2)11-7-5-10-6-8-11;1-6-2-4-7-5-3-6/h4,10H,3,5-8H2,1-2H3;2-5H2,1H3/b9-4-; |
| InChIKey | IWULWYQCNSOOGH-WONROIIJSA-N |
| XLogP | 1.15 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine?
The IUPAC name of 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine (CID 143004800) is 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine.
What is the SMILES notation for 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine?
The canonical SMILES for 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine is CC/C=C(/C)N1CCNCC1.CN1CCOCC1.
What is the InChIKey of 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine?
The InChIKey is IWULWYQCNSOOGH-WONROIIJSA-N. The full InChI is InChI=1S/C9H18N2.C5H11NO/c1-3-4-9(2)11-7-5-10-6-8-11;1-6-2-4-7-5-3-6/h4,10H,3,5-8H2,1-2H3;2-5H2,1H3/b9-4-;.
What are the key properties of 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine?
4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine has a molecular weight of 255.41 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylmorpholine;1-[(Z)-pent-2-en-2-yl]piperazine is sourced from PubChem (CID 143004800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).